C34H24O2 — CID 98174899
(1R,2S,6S,7R)-4,5,8,9-tetraphenyltricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione (PubChem CID 98174899) has the molecular formula C34H24O2 and a molecular weight of 464.56 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4,5,8,9-tetraphenyltricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione.
| Compound Name | (1R,2S,6S,7R)-4,5,8,9-tetraphenyltricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione |
|---|---|
| PubChem CID | 98174899 |
| Molecular Formula | C34H24O2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (1R,2S,6S,7R)-4,5,8,9-tetraphenyltricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione |
| SMILES | O=C1[C@H]2C(c3ccccc3)=C(c3ccccc3)[C@H]1[C@H]1C(c3ccccc3)=C(c3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C34H24O2/c35-33-28(24-19-11-4-12-20-24)27(23-17-9-3-10-18-23)29-30-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)31(32(29)33)34(30)36/h1-20,29-32H/t29-,30+,31+,32+/m1/s1 |
| InChIKey | VBJWZTVHAHQICF-ZLESDFJESA-N |
| XLogP | 6.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|