C22H16Cl2O — CID 102418640
(1S,2S,6R,7R)-4,5-bis(4-chlorophenyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 102418640) has the molecular formula C22H16Cl2O and a molecular weight of 367.28 g/mol. Its IUPAC name is (1S,2S,6R,7R)-4,5-bis(4-chlorophenyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2S,6R,7R)-4,5-bis(4-chlorophenyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 102418640 |
| Molecular Formula | C22H16Cl2O |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (1S,2S,6R,7R)-4,5-bis(4-chlorophenyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(c2ccc(Cl)cc2)=C(c2ccc(Cl)cc2)[C@H]2[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C22H16Cl2O/c23-16-7-3-12(4-8-16)18-19-14-1-2-15(11-14)21(19)22(25)20(18)13-5-9-17(24)10-6-13/h1-10,14-15,19,21H,11H2/t14-,15+,19-,21-/m0/s1 |
| InChIKey | XWVISMRFGHEYKF-YOBSMXQVSA-N |
| XLogP | 5.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|