C11H9ClO2 — CID 11908484
(1S,2R,7R,8R)-4-chlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 11908484) has the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. Its IUPAC name is (1S,2R,7R,8R)-4-chlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1S,2R,7R,8R)-4-chlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 11908484 |
| Molecular Formula | C11H9ClO2 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | (1S,2R,7R,8R)-4-chlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | O=C1C(Cl)=CC(=O)[C@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C11H9ClO2/c12-7-4-8(13)9-5-1-2-6(3-5)10(9)11(7)14/h1-2,4-6,9-10H,3H2/t5-,6+,9-,10+/m0/s1 |
| InChIKey | LNRANVGBMBSCMY-FTEGDLIOSA-N |
| XLogP | 1.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|