C17H13F3O — CID 134843985
(1S,2S,6R,7R)-5-phenyl-4-(trifluoromethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 134843985) has the molecular formula C17H13F3O and a molecular weight of 290.28 g/mol. Its IUPAC name is (1S,2S,6R,7R)-5-phenyl-4-(trifluoromethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2S,6R,7R)-5-phenyl-4-(trifluoromethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 134843985 |
| Molecular Formula | C17H13F3O |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1S,2S,6R,7R)-5-phenyl-4-(trifluoromethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(C(F)(F)F)=C(c2ccccc2)[C@H]2[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C17H13F3O/c18-17(19,20)15-13(9-4-2-1-3-5-9)12-10-6-7-11(8-10)14(12)16(15)21/h1-7,10-12,14H,8H2/t10-,11+,12-,14-/m0/s1 |
| InChIKey | YGEKYRFUHLFHFC-OPDFLTKYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|