C22H16Cl2 — CID 11759906
(1R,5S)-3-[2,2-bis(4-chlorophenyl)ethenylidene]tricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 11759906) has the molecular formula C22H16Cl2 and a molecular weight of 351.28 g/mol. Its IUPAC name is (1R,5S)-3-[2,2-bis(4-chlorophenyl)ethenylidene]tricyclo[3.2.1.02,4]oct-6-ene.
| Compound Name | (1R,5S)-3-[2,2-bis(4-chlorophenyl)ethenylidene]tricyclo[3.2.1.02,4]oct-6-ene |
|---|---|
| PubChem CID | 11759906 |
| Molecular Formula | C22H16Cl2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (1R,5S)-3-[2,2-bis(4-chlorophenyl)ethenylidene]tricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | Clc1ccc(C(=C=C2C3C2[C@H]2C=C[C@@H]3C2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H16Cl2/c23-17-7-3-13(4-8-17)19(14-5-9-18(24)10-6-14)12-20-21-15-1-2-16(11-15)22(20)21/h1-10,15-16,21-22H,11H2/t15-,16+,21?,22? |
| InChIKey | LXFRKYBXHMZUDF-MBWAJUJLSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|