C20H16Cl2 — CID 135072018
6-[2,2-bis(4-chlorophenyl)ethenylidene]bicyclo[3.1.0]hexane (PubChem CID 135072018) has the molecular formula C20H16Cl2 and a molecular weight of 327.25 g/mol. Its IUPAC name is 6-[2,2-bis(4-chlorophenyl)ethenylidene]bicyclo[3.1.0]hexane.
| Compound Name | 6-[2,2-bis(4-chlorophenyl)ethenylidene]bicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 135072018 |
| Molecular Formula | C20H16Cl2 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 6-[2,2-bis(4-chlorophenyl)ethenylidene]bicyclo[3.1.0]hexane |
| SMILES | Clc1ccc(C(=C=C2C3CCCC23)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H16Cl2/c21-15-8-4-13(5-9-15)19(14-6-10-16(22)11-7-14)12-20-17-2-1-3-18(17)20/h4-11,17-18H,1-3H2 |
| InChIKey | JQDWHEUAMYHUDP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |