C20H18 — CID 101186507
(1S,5R)-6-(2,2-diphenylethenylidene)bicyclo[3.1.0]hexane (PubChem CID 101186507) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1S,5R)-6-(2,2-diphenylethenylidene)bicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-6-(2,2-diphenylethenylidene)bicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 101186507 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1S,5R)-6-(2,2-diphenylethenylidene)bicyclo[3.1.0]hexane |
| SMILES | C(=C(c1ccccc1)c1ccccc1)=C1[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C20H18/c1-3-8-15(9-4-1)19(16-10-5-2-6-11-16)14-20-17-12-7-13-18(17)20/h1-6,8-11,17-18H,7,12-13H2/t17-,18+ |
| InChIKey | SAIQLJUVYDJJQN-HDICACEKSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |