C20H20O — CID 134977363
(1S)-2-(2,2-diphenylethenylidene)cyclohexan-1-ol (PubChem CID 134977363) has the molecular formula C20H20O and a molecular weight of 276.38 g/mol. Its IUPAC name is (1S)-2-(2,2-diphenylethenylidene)cyclohexan-1-ol.
| Compound Name | (1S)-2-(2,2-diphenylethenylidene)cyclohexan-1-ol |
|---|---|
| PubChem CID | 134977363 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (1S)-2-(2,2-diphenylethenylidene)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCCC1=C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20O/c21-20-14-8-7-13-18(20)15-19(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-6,9-12,20-21H,7-8,13-14H2/t20-/m0/s1 |
| InChIKey | JFUJCYXCTHJICA-FQEVSTJZSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |