C24H17F3O — CID 142808739
(5S)-4-(3,5-difluorophenyl)-2-(4-fluorophenyl)-5-methyl-3-phenylcyclopent-2-en-1-one (PubChem CID 142808739) has the molecular formula C24H17F3O and a molecular weight of 378.39 g/mol. Its IUPAC name is (5S)-4-(3,5-difluorophenyl)-2-(4-fluorophenyl)-5-methyl-3-phenylcyclopent-2-en-1-one.
| Compound Name | (5S)-4-(3,5-difluorophenyl)-2-(4-fluorophenyl)-5-methyl-3-phenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142808739 |
| Molecular Formula | C24H17F3O |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (5S)-4-(3,5-difluorophenyl)-2-(4-fluorophenyl)-5-methyl-3-phenylcyclopent-2-en-1-one |
| SMILES | C[C@@H]1C(=O)C(c2ccc(F)cc2)=C(c2ccccc2)C1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H17F3O/c1-14-21(17-11-19(26)13-20(27)12-17)22(15-5-3-2-4-6-15)23(24(14)28)16-7-9-18(25)10-8-16/h2-14,21H,1H3/t14-,21?/m0/s1 |
| InChIKey | SUBZYRXJPAIDHL-YXWRBFHGSA-N |
| XLogP | 6.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|