C17H14FNO4S — CID 20658572
4-[4-(4-fluorophenyl)-2-methyl-5-oxo-2H-furan-3-yl]benzenesulfonamide (PubChem CID 20658572) has the molecular formula C17H14FNO4S and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-2-methyl-5-oxo-2H-furan-3-yl]benzenesulfonamide.
| Compound Name | 4-[4-(4-fluorophenyl)-2-methyl-5-oxo-2H-furan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 20658572 |
| Molecular Formula | C17H14FNO4S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-2-methyl-5-oxo-2H-furan-3-yl]benzenesulfonamide |
| SMILES | CC1OC(=O)C(c2ccc(F)cc2)=C1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H14FNO4S/c1-10-15(11-4-8-14(9-5-11)24(19,21)22)16(17(20)23-10)12-2-6-13(18)7-3-12/h2-10H,1H3,(H2,19,21,22) |
| InChIKey | KGTVCKLUJWNMRJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|