C16H14FN3O2S — CID 177458625
4-[3-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]benzenesulfonamide (PubChem CID 177458625) has the molecular formula C16H14FN3O2S and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[3-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177458625 |
| Molecular Formula | C16H14FN3O2S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]benzenesulfonamide |
| SMILES | Cc1[nH]nc(-c2ccc(F)cc2)c1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H14FN3O2S/c1-10-15(11-4-8-14(9-5-11)23(18,21)22)16(20-19-10)12-2-6-13(17)7-3-12/h2-9H,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | DELHCDOLERZQCN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |