C17H14N3O4S- — CID 18914586
4-(4-methylphenyl)-3-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxylate (PubChem CID 18914586) has the molecular formula C17H14N3O4S- and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | 4-(4-methylphenyl)-3-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 18914586 |
| Molecular Formula | C17H14N3O4S- |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-(4-methylphenyl)-3-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxylate |
| SMILES | Cc1ccc(-c2c(-c3ccc(S(N)(=O)=O)cc3)n[nH]c2C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H15N3O4S/c1-10-2-4-11(5-3-10)14-15(19-20-16(14)17(21)22)12-6-8-13(9-7-12)25(18,23)24/h2-9H,1H3,(H,19,20)(H,21,22)(H2,18,23,24)/p-1 |
| InChIKey | DBPRVJWMTFYOMO-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |