C24H17F3O2 — CID 91423117
(4S,5S)-4-(3,5-difluorophenyl)-2-(4-fluorophenyl)-4-hydroxy-5-methyl-3-phenylcyclopent-2-en-1-one (PubChem CID 91423117) has the molecular formula C24H17F3O2 and a molecular weight of 394.39 g/mol. Its IUPAC name is (4S,5S)-4-(3,5-difluorophenyl)-2-(4-fluorophenyl)-4-hydroxy-5-methyl-3-phenylcyclopent-2-en-1-one.
| Compound Name | (4S,5S)-4-(3,5-difluorophenyl)-2-(4-fluorophenyl)-4-hydroxy-5-methyl-3-phenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 91423117 |
| Molecular Formula | C24H17F3O2 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (4S,5S)-4-(3,5-difluorophenyl)-2-(4-fluorophenyl)-4-hydroxy-5-methyl-3-phenylcyclopent-2-en-1-one |
| SMILES | C[C@@H]1C(=O)C(c2ccc(F)cc2)=C(c2ccccc2)[C@@]1(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H17F3O2/c1-14-23(28)21(15-7-9-18(25)10-8-15)22(16-5-3-2-4-6-16)24(14,29)17-11-19(26)13-20(27)12-17/h2-14,29H,1H3/t14-,24+/m1/s1 |
| InChIKey | QFGSOZBPMDHJGM-SHACYNPGSA-N |
| XLogP | 5.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|