C25H19F3O2 — CID 142808679
4-hydroxy-5-methyl-2,3-diphenyl-4-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-one (PubChem CID 142808679) has the molecular formula C25H19F3O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-2,3-diphenyl-4-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-one.
| Compound Name | 4-hydroxy-5-methyl-2,3-diphenyl-4-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142808679 |
| Molecular Formula | C25H19F3O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-hydroxy-5-methyl-2,3-diphenyl-4-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-one |
| SMILES | CC1C(=O)C(c2ccccc2)=C(c2ccccc2)C1(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H19F3O2/c1-16-23(29)21(17-8-4-2-5-9-17)22(18-10-6-3-7-11-18)24(16,30)19-12-14-20(15-13-19)25(26,27)28/h2-16,30H,1H3 |
| InChIKey | DBIHTJQELMXMLA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|