C22H15ClO3 — CID 132532149
3-(4-chlorophenyl)-5-hydroxy-4,5-diphenylfuran-2-one (PubChem CID 132532149) has the molecular formula C22H15ClO3 and a molecular weight of 362.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-hydroxy-4,5-diphenylfuran-2-one.
| Compound Name | 3-(4-chlorophenyl)-5-hydroxy-4,5-diphenylfuran-2-one |
|---|---|
| PubChem CID | 132532149 |
| Molecular Formula | C22H15ClO3 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-(4-chlorophenyl)-5-hydroxy-4,5-diphenylfuran-2-one |
| SMILES | O=C1OC(O)(c2ccccc2)C(c2ccccc2)=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H15ClO3/c23-18-13-11-15(12-14-18)19-20(16-7-3-1-4-8-16)22(25,26-21(19)24)17-9-5-2-6-10-17/h1-14,25H |
| InChIKey | IDWKEEZTFLMORP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|