C27H22O4 — CID 154720830
ethyl (E)-3-[(2R)-5-oxo-2,3,4-triphenylfuran-2-yl]prop-2-enoate (PubChem CID 154720830) has the molecular formula C27H22O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is ethyl (E)-3-[(2R)-5-oxo-2,3,4-triphenylfuran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R)-5-oxo-2,3,4-triphenylfuran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 154720830 |
| Molecular Formula | C27H22O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | ethyl (E)-3-[(2R)-5-oxo-2,3,4-triphenylfuran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@]1(c2ccccc2)OC(=O)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C27H22O4/c1-2-30-23(28)18-19-27(22-16-10-5-11-17-22)25(21-14-8-4-9-15-21)24(26(29)31-27)20-12-6-3-7-13-20/h3-19H,2H2,1H3/b19-18+/t27-/m1/s1 |
| InChIKey | SDCIHYOSXIBCIJ-SRUCCPAXSA-N |
| XLogP | 5.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|