C28H24O5 — CID 91163780
1-O-ethyl 2-O-[(1S,5R)-5-methyl-4-oxo-1,2,3-triphenylcyclopent-2-en-1-yl] oxalate (PubChem CID 91163780) has the molecular formula C28H24O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-O-ethyl 2-O-[(1S,5R)-5-methyl-4-oxo-1,2,3-triphenylcyclopent-2-en-1-yl] oxalate.
| Compound Name | 1-O-ethyl 2-O-[(1S,5R)-5-methyl-4-oxo-1,2,3-triphenylcyclopent-2-en-1-yl] oxalate |
|---|---|
| PubChem CID | 91163780 |
| Molecular Formula | C28H24O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-O-ethyl 2-O-[(1S,5R)-5-methyl-4-oxo-1,2,3-triphenylcyclopent-2-en-1-yl] oxalate |
| SMILES | CCOC(=O)C(=O)O[C@@]1(c2ccccc2)C(c2ccccc2)=C(c2ccccc2)C(=O)[C@@H]1C |
| InChI | InChI=1S/C28H24O5/c1-3-32-26(30)27(31)33-28(22-17-11-6-12-18-22)19(2)25(29)23(20-13-7-4-8-14-20)24(28)21-15-9-5-10-16-21/h4-19H,3H2,1-2H3/t19-,28-/m0/s1 |
| InChIKey | DCTNYCKEKZXIJH-VKGTZQKMSA-N |
| XLogP | 4.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|