C31H24O3 — CID 40734136
ethyl (1S,8R)-1,8,10-triphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9-carboxylate (PubChem CID 40734136) has the molecular formula C31H24O3 and a molecular weight of 444.53 g/mol. Its IUPAC name is ethyl (1S,8R)-1,8,10-triphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9-carboxylate.
| Compound Name | ethyl (1S,8R)-1,8,10-triphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9-carboxylate |
|---|---|
| PubChem CID | 40734136 |
| Molecular Formula | C31H24O3 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | ethyl (1S,8R)-1,8,10-triphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)[C@@]2(c3ccccc3)O[C@]1(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C31H24O3/c1-2-33-29(32)28-27(22-14-6-3-7-15-22)30(23-16-8-4-9-17-23)25-20-12-13-21-26(25)31(28,34-30)24-18-10-5-11-19-24/h3-21H,2H2,1H3/t30-,31+/m0/s1 |
| InChIKey | FOUUOIDVZJCPLU-IOWSJCHKSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |