C35H32O5 — CID 91745904
diethyl 2-[(1,9-diphenyl-16-oxatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-yl)methyl]propanedioate (PubChem CID 91745904) has the molecular formula C35H32O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is diethyl 2-[(1,9-diphenyl-16-oxatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-yl)methyl]propanedioate.
| Compound Name | diethyl 2-[(1,9-diphenyl-16-oxatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 91745904 |
| Molecular Formula | C35H32O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | diethyl 2-[(1,9-diphenyl-16-oxatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(CC1c2ccccc2C2(c3ccccc3)OC1(c1ccccc1)c1ccccc12)C(=O)OCC |
| InChI | InChI=1S/C35H32O5/c1-3-38-32(36)27(33(37)39-4-2)23-31-26-19-11-12-20-28(26)34(24-15-7-5-8-16-24)29-21-13-14-22-30(29)35(31,40-34)25-17-9-6-10-18-25/h5-22,27,31H,3-4,23H2,1-2H3 |
| InChIKey | IBZCQDAFQDMXBJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|