C20H20O3 — CID 143660041
ethyl 4-formyl-4-phenyl-2,3-dihydro-1H-naphthalene-1-carboxylate (PubChem CID 143660041) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl 4-formyl-4-phenyl-2,3-dihydro-1H-naphthalene-1-carboxylate.
| Compound Name | ethyl 4-formyl-4-phenyl-2,3-dihydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 143660041 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 4-formyl-4-phenyl-2,3-dihydro-1H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(C=O)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C20H20O3/c1-2-23-19(22)17-12-13-20(14-21,15-8-4-3-5-9-15)18-11-7-6-10-16(17)18/h3-11,14,17H,2,12-13H2,1H3 |
| InChIKey | ZPXZOBMGZJPVTH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|