C25H30O3 — CID 143660230
but-1-ene;ethyl (4R)-4-acetyl-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate (PubChem CID 143660230) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is but-1-ene;ethyl (4R)-4-acetyl-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate.
| Compound Name | but-1-ene;ethyl (4R)-4-acetyl-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 143660230 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | but-1-ene;ethyl (4R)-4-acetyl-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate |
| SMILES | C=CCC.CCOC(=O)C1(c2ccccc2)CC[C@@H](C(C)=O)c2ccccc21 |
| InChI | InChI=1S/C21H22O3.C4H8/c1-3-24-20(23)21(16-9-5-4-6-10-16)14-13-17(15(2)22)18-11-7-8-12-19(18)21;1-3-4-2/h4-12,17H,3,13-14H2,1-2H3;3H,1,4H2,2H3/t17-,21?;/m0./s1 |
| InChIKey | JSYXDTDAERQGMI-JJTBHEEUSA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|