C31H33NO4 — CID 59150736
ethyl (1S,4S)-4-(5-benzamidopentanoyl)-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate (PubChem CID 59150736) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is ethyl (1S,4S)-4-(5-benzamidopentanoyl)-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1S,4S)-4-(5-benzamidopentanoyl)-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 59150736 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | ethyl (1S,4S)-4-(5-benzamidopentanoyl)-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)CC[C@H](C(=O)CCCCNC(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H33NO4/c1-2-36-30(35)31(24-15-7-4-8-16-24)21-20-26(25-17-9-10-18-27(25)31)28(33)19-11-12-22-32-29(34)23-13-5-3-6-14-23/h3-10,13-18,26H,2,11-12,19-22H2,1H3,(H,32,34)/t26-,31-/m0/s1 |
| InChIKey | CQYATJBKKPTZOI-HVNZXBJASA-N |
| XLogP | 5.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|