C32H34O5 — CID 59150752
ethyl (1R,4S)-4-[6-(2-methoxyphenyl)-6-oxohexanoyl]-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate (PubChem CID 59150752) has the molecular formula C32H34O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is ethyl (1R,4S)-4-[6-(2-methoxyphenyl)-6-oxohexanoyl]-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1R,4S)-4-[6-(2-methoxyphenyl)-6-oxohexanoyl]-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 59150752 |
| Molecular Formula | C32H34O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | ethyl (1R,4S)-4-[6-(2-methoxyphenyl)-6-oxohexanoyl]-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(c2ccccc2)CC[C@H](C(=O)CCCCC(=O)c2ccccc2OC)c2ccccc21 |
| InChI | InChI=1S/C32H34O5/c1-3-37-31(35)32(23-13-5-4-6-14-23)22-21-25(24-15-7-9-17-27(24)32)28(33)18-10-11-19-29(34)26-16-8-12-20-30(26)36-2/h4-9,12-17,20,25H,3,10-11,18-19,21-22H2,1-2H3/t25-,32+/m0/s1 |
| InChIKey | XQQZRTGPWPRLEC-ZOYWYXQUSA-N |
| XLogP | 6.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|