C23H20O7 — CID 134869445
dimethyl (1S,8R)-1-(acetyloxymethyl)-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 134869445) has the molecular formula C23H20O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is dimethyl (1S,8R)-1-(acetyloxymethyl)-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,8R)-1-(acetyloxymethyl)-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 134869445 |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | dimethyl (1S,8R)-1-(acetyloxymethyl)-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(COC(C)=O)O[C@]1(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C23H20O7/c1-14(24)29-13-22-16-11-7-8-12-17(16)23(30-22,15-9-5-4-6-10-15)19(21(26)28-3)18(22)20(25)27-2/h4-12H,13H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | BHRKVHJPDUDIOF-XZOQPEGZSA-N |
| XLogP | 2.38 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|