C21H16O4S — CID 11879299
methyl (1R)-1-oxo-3,3-diphenyl-2,1λ4-benzoxathiole-7-carboxylate (PubChem CID 11879299) has the molecular formula C21H16O4S and a molecular weight of 364.42 g/mol. Its IUPAC name is methyl (1R)-1-oxo-3,3-diphenyl-2,1λ4-benzoxathiole-7-carboxylate.
| Compound Name | methyl (1R)-1-oxo-3,3-diphenyl-2,1λ4-benzoxathiole-7-carboxylate |
|---|---|
| PubChem CID | 11879299 |
| Molecular Formula | C21H16O4S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | methyl (1R)-1-oxo-3,3-diphenyl-2,1λ4-benzoxathiole-7-carboxylate |
| SMILES | COC(=O)c1cccc2c1[S@](=O)OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16O4S/c1-24-20(22)17-13-8-14-18-19(17)26(23)25-21(18,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-14H,1H3/t26-/m1/s1 |
| InChIKey | ITHKHPTWLYXMOA-AREMUKBSSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |