C24H20O9 — CID 100981651
dimethyl (1S,9R)-1-methoxy-9-(2-methoxycarbonylphenyl)-7-oxo-12-oxatricyclo[7.2.1.02,8]dodeca-2(8),3,5,10-tetraene-10,11-dicarboxylate (PubChem CID 100981651) has the molecular formula C24H20O9 and a molecular weight of 452.42 g/mol. Its IUPAC name is dimethyl (1S,9R)-1-methoxy-9-(2-methoxycarbonylphenyl)-7-oxo-12-oxatricyclo[7.2.1.02,8]dodeca-2(8),3,5,10-tetraene-10,11-dicarboxylate.
| Compound Name | dimethyl (1S,9R)-1-methoxy-9-(2-methoxycarbonylphenyl)-7-oxo-12-oxatricyclo[7.2.1.02,8]dodeca-2(8),3,5,10-tetraene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 100981651 |
| Molecular Formula | C24H20O9 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | dimethyl (1S,9R)-1-methoxy-9-(2-methoxycarbonylphenyl)-7-oxo-12-oxatricyclo[7.2.1.02,8]dodeca-2(8),3,5,10-tetraene-10,11-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(c3ccccc3C(=O)OC)O[C@@]1(OC)c1ccccc(=O)c12 |
| InChI | InChI=1S/C24H20O9/c1-29-20(26)13-9-5-6-10-14(13)23-17-15(11-7-8-12-16(17)25)24(32-4,33-23)19(22(28)31-3)18(23)21(27)30-2/h5-12H,1-4H3/t23-,24+/m1/s1 |
| InChIKey | AYZYOVAKFLFDLV-RPWUZVMVSA-N |
| XLogP | 1.56 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|