About methyl 2-phosphanylbenzoate
methyl 2-phosphanylbenzoate (PubChem CID 156736008) has the molecular formula C8H9O2P
and a molecular weight of 168.13 g/mol. Its IUPAC name is methyl 2-phosphanylbenzoate.
Molecular Properties
| Compound Name | methyl 2-phosphanylbenzoate |
| PubChem CID | 156736008 |
| Molecular Formula | C8H9O2P |
| Molecular Weight | 168.13 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | methyl 2-phosphanylbenzoate |
| SMILES | COC(=O)c1ccccc1P |
| InChI | InChI=1S/C8H9O2P/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5H,11H2,1H3 |
| InChIKey | AJLUVFZJRJHODT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.13 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-phosphanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phosphanylbenzoate?
The IUPAC name of methyl 2-phosphanylbenzoate (CID 156736008) is methyl 2-phosphanylbenzoate.
What is the SMILES notation for methyl 2-phosphanylbenzoate?
The canonical SMILES for methyl 2-phosphanylbenzoate is COC(=O)c1ccccc1P.
What is the InChIKey of methyl 2-phosphanylbenzoate?
The InChIKey is AJLUVFZJRJHODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O2P/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5H,11H2,1H3.
What are the key properties of methyl 2-phosphanylbenzoate?
methyl 2-phosphanylbenzoate has a molecular weight of 168.13 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phosphanylbenzoate is sourced from PubChem (CID 156736008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).