C32H34O7 — CID 177498166
dimethyl 1-[(Z)-1-(3,4-dihydro-2H-pyran-6-yl)-1-methoxyhex-1-en-2-yl]-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 177498166) has the molecular formula C32H34O7 and a molecular weight of 530.62 g/mol. Its IUPAC name is dimethyl 1-[(Z)-1-(3,4-dihydro-2H-pyran-6-yl)-1-methoxyhex-1-en-2-yl]-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl 1-[(Z)-1-(3,4-dihydro-2H-pyran-6-yl)-1-methoxyhex-1-en-2-yl]-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 177498166 |
| Molecular Formula | C32H34O7 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | dimethyl 1-[(Z)-1-(3,4-dihydro-2H-pyran-6-yl)-1-methoxyhex-1-en-2-yl]-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | CCCC/C(=C(/OC)C1=CCCCO1)C12OC(c3ccccc3)(C(C(=O)OC)=C1C(=O)OC)c1ccccc12 |
| InChI | InChI=1S/C32H34O7/c1-5-6-16-24(28(35-2)25-19-12-13-20-38-25)32-23-18-11-10-17-22(23)31(39-32,21-14-8-7-9-15-21)26(29(33)36-3)27(32)30(34)37-4/h7-11,14-15,17-19H,5-6,12-13,16,20H2,1-4H3/b28-24- |
| InChIKey | UYAGNBYKANUKIR-COOPMVRXSA-N |
| XLogP | 5.60 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|