C30H32O6 — CID 101430316
dimethyl (1Z,9Z,12E)-14-butyl-13-methoxy-12-methyl-8-phenyl-15-oxatricyclo[6.6.1.02,7]pentadeca-1(14),2,4,6,9,12-hexaene-9,10-dicarboxylate (PubChem CID 101430316) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is dimethyl (1Z,9Z,12E)-14-butyl-13-methoxy-12-methyl-8-phenyl-15-oxatricyclo[6.6.1.02,7]pentadeca-1(14),2,4,6,9,12-hexaene-9,10-dicarboxylate.
| Compound Name | dimethyl (1Z,9Z,12E)-14-butyl-13-methoxy-12-methyl-8-phenyl-15-oxatricyclo[6.6.1.02,7]pentadeca-1(14),2,4,6,9,12-hexaene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 101430316 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | dimethyl (1Z,9Z,12E)-14-butyl-13-methoxy-12-methyl-8-phenyl-15-oxatricyclo[6.6.1.02,7]pentadeca-1(14),2,4,6,9,12-hexaene-9,10-dicarboxylate |
| SMILES | CCCCC1=C2/OC(c3ccccc3)(/C(C(=O)OC)=C(/C(=O)OC)C\C(C)=C/1OC)c1ccccc12 |
| InChI | InChI=1S/C30H32O6/c1-6-7-15-22-26(33-3)19(2)18-23(28(31)34-4)25(29(32)35-5)30(20-13-9-8-10-14-20)24-17-12-11-16-21(24)27(22)36-30/h8-14,16-17H,6-7,15,18H2,1-5H3/b25-23+,26-19+,27-22- |
| InChIKey | VRULKORFMADTMP-PSZBRRLCSA-N |
| XLogP | 5.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |