C14H14O2 — CID 71377802
1-(3,4-dihydro-2H-pyran-6-yl)-3-phenylprop-2-en-1-one (PubChem CID 71377802) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-3-phenylprop-2-en-1-one.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 71377802 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)C1=CCCCO1 |
| InChI | InChI=1S/C14H14O2/c15-13(14-8-4-5-11-16-14)10-9-12-6-2-1-3-7-12/h1-3,6-10H,4-5,11H2 |
| InChIKey | YBKHUCCRHKHEQK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|