C17H20O2 — CID 135079434
(2E)-2-benzylidene-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one (PubChem CID 135079434) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2E)-2-benzylidene-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one.
| Compound Name | (2E)-2-benzylidene-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one |
|---|---|
| PubChem CID | 135079434 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2E)-2-benzylidene-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one |
| SMILES | CCC/C(=C\c1ccccc1)C(=O)C1=CCCCO1 |
| InChI | InChI=1S/C17H20O2/c1-2-8-15(13-14-9-4-3-5-10-14)17(18)16-11-6-7-12-19-16/h3-5,9-11,13H,2,6-8,12H2,1H3/b15-13+ |
| InChIKey | WVYXFKMDKLXDFT-FYWRMAATSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|