C12H13NO4 — CID 131845862
ethyl 5-hydroxy-5-phenyl-4H-1,2-oxazole-3-carboxylate (PubChem CID 131845862) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is ethyl 5-hydroxy-5-phenyl-4H-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-5-phenyl-4H-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 131845862 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | ethyl 5-hydroxy-5-phenyl-4H-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C12H13NO4/c1-2-16-11(14)10-8-12(15,17-13-10)9-6-4-3-5-7-9/h3-7,15H,2,8H2,1H3 |
| InChIKey | KPUKEFMXQLVGFN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |