About (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate
(5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 71351524) has the molecular formula C8H10NO5-
and a molecular weight of 200.17 g/mol. Its IUPAC name is (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate |
| PubChem CID | 71351524 |
| Molecular Formula | C8H10NO5- |
| Molecular Weight | 200.17 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@](C)(C(=O)[O-])C1 |
| InChI | InChI=1S/C8H11NO5/c1-3-13-6(10)5-4-8(2,7(11)12)14-9-5/h3-4H2,1-2H3,(H,11,12)/p-1/t8-/m0/s1 |
| InChIKey | WNKKTXZDEVWHHD-QMMMGPOBSA-M |
| XLogP | -1.17 |
| TPSA | 88.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.17 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The IUPAC name of (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate (CID 71351524) is (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The canonical SMILES for (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate is CCOC(=O)C1=NO[C@](C)(C(=O)[O-])C1.
What is the InChIKey of (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
The InChIKey is WNKKTXZDEVWHHD-QMMMGPOBSA-M. The full InChI is InChI=1S/C8H11NO5/c1-3-13-6(10)5-4-8(2,7(11)12)14-9-5/h3-4H2,1-2H3,(H,11,12)/p-1/t8-/m0/s1.
What are the key properties of (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate?
(5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate has a molecular weight of 200.17 g/mol, XLogP of -1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3-ethoxycarbonyl-5-methyl-4H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 71351524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).