About ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate
ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate (PubChem CID 159620761) has the molecular formula C11H18NO3S-
and a molecular weight of 244.34 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate.
Molecular Properties
| Compound Name | ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate |
| PubChem CID | 159620761 |
| Molecular Formula | C11H18NO3S- |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate |
| SMILES | C=C(C)[O-].CCOC(=O)C1=NC(C)(C)SC1 |
| InChI | InChI=1S/C8H13NO2S.C3H6O/c1-4-11-7(10)6-5-12-8(2,3)9-6;1-3(2)4/h4-5H2,1-3H3;4H,1H2,2H3/p-1 |
| InChIKey | YXUYGQMUKBTXCN-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate?
The IUPAC name of ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate (CID 159620761) is ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate.
What is the SMILES notation for ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate?
The canonical SMILES for ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate is C=C(C)[O-].CCOC(=O)C1=NC(C)(C)SC1.
What is the InChIKey of ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate?
The InChIKey is YXUYGQMUKBTXCN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H13NO2S.C3H6O/c1-4-11-7(10)6-5-12-8(2,3)9-6;1-3(2)4/h4-5H2,1-3H3;4H,1H2,2H3/p-1.
What are the key properties of ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate?
ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate has a molecular weight of 244.34 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-dimethyl-5H-1,3-thiazole-4-carboxylate;prop-1-en-2-olate is sourced from PubChem (CID 159620761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).