C12H20O2S — CID 104503804
ethyl 2-(4,4-dimethylthian-3-ylidene)propanoate (PubChem CID 104503804) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is ethyl 2-(4,4-dimethylthian-3-ylidene)propanoate.
| Compound Name | ethyl 2-(4,4-dimethylthian-3-ylidene)propanoate |
|---|---|
| PubChem CID | 104503804 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | ethyl 2-(4,4-dimethylthian-3-ylidene)propanoate |
| SMILES | CCOC(=O)C(C)=C1CSCCC1(C)C |
| InChI | InChI=1S/C12H20O2S/c1-5-14-11(13)9(2)10-8-15-7-6-12(10,3)4/h5-8H2,1-4H3 |
| InChIKey | LZUVUMZCWFVIQH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|