C17H26O4 — CID 147643757
ethyl 2-[(3aR,6aS)-3a,6a-dimethylspiro[1,3,4,6-tetrahydropentalene-5,2'-1,3-dioxolane]-2-ylidene]propanoate (PubChem CID 147643757) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is ethyl 2-[(3aR,6aS)-3a,6a-dimethylspiro[1,3,4,6-tetrahydropentalene-5,2'-1,3-dioxolane]-2-ylidene]propanoate.
| Compound Name | ethyl 2-[(3aR,6aS)-3a,6a-dimethylspiro[1,3,4,6-tetrahydropentalene-5,2'-1,3-dioxolane]-2-ylidene]propanoate |
|---|---|
| PubChem CID | 147643757 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | ethyl 2-[(3aR,6aS)-3a,6a-dimethylspiro[1,3,4,6-tetrahydropentalene-5,2'-1,3-dioxolane]-2-ylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=C1/C[C@@]2(C)CC3(C[C@@]2(C)C1)OCCO3 |
| InChI | InChI=1S/C17H26O4/c1-5-19-14(18)12(2)13-8-15(3)10-17(20-6-7-21-17)11-16(15,4)9-13/h5-11H2,1-4H3/b13-12-/t15-,16+/m0/s1 |
| InChIKey | GIDJIENOHFOWLJ-UPJGQAATSA-N |
| XLogP | 3.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|