C15H24O4 — CID 155087803
ethyl 2-[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]propanoate (PubChem CID 155087803) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is ethyl 2-[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]propanoate.
| Compound Name | ethyl 2-[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]propanoate |
|---|---|
| PubChem CID | 155087803 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | ethyl 2-[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]propanoate |
| SMILES | CCOC(=O)C(C)C1C[C@@H]2CC3(C[C@@H]2C1)OCCO3 |
| InChI | InChI=1S/C15H24O4/c1-3-17-14(16)10(2)11-6-12-8-15(9-13(12)7-11)18-4-5-19-15/h10-13H,3-9H2,1-2H3/t10?,11?,12-,13+ |
| InChIKey | BQXUZNNKILGZJL-BPNZPQAUSA-N |
| XLogP | 2.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |