C14H22O3 — CID 53348444
(3'aR,4'R,6'aS)-3'a-methyl-4'-propan-2-ylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-one (PubChem CID 53348444) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3'aR,4'R,6'aS)-3'a-methyl-4'-propan-2-ylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-one.
| Compound Name | (3'aR,4'R,6'aS)-3'a-methyl-4'-propan-2-ylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-one |
|---|---|
| PubChem CID | 53348444 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (3'aR,4'R,6'aS)-3'a-methyl-4'-propan-2-ylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-one |
| SMILES | CC(C)[C@H]1CC2(OCCO2)[C@@H]2C(=O)CC[C@]12C |
| InChI | InChI=1S/C14H22O3/c1-9(2)10-8-14(16-6-7-17-14)12-11(15)4-5-13(10,12)3/h9-10,12H,4-8H2,1-3H3/t10-,12-,13-/m1/s1 |
| InChIKey | QQWABTZVELDQIM-RAIGVLPGSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |