C16H26O3 — CID 139057878
(1R,3aR,9aR)-1,8,8-trimethylspiro[1,2,3,3a,4,6,7,9a-octahydrocyclopenta[8]annulene-5,2'-1,3-dioxolane]-9-one (PubChem CID 139057878) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (1R,3aR,9aR)-1,8,8-trimethylspiro[1,2,3,3a,4,6,7,9a-octahydrocyclopenta[8]annulene-5,2'-1,3-dioxolane]-9-one.
| Compound Name | (1R,3aR,9aR)-1,8,8-trimethylspiro[1,2,3,3a,4,6,7,9a-octahydrocyclopenta[8]annulene-5,2'-1,3-dioxolane]-9-one |
|---|---|
| PubChem CID | 139057878 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (1R,3aR,9aR)-1,8,8-trimethylspiro[1,2,3,3a,4,6,7,9a-octahydrocyclopenta[8]annulene-5,2'-1,3-dioxolane]-9-one |
| SMILES | C[C@@H]1CC[C@@H]2CC3(CCC(C)(C)C(=O)[C@@H]21)OCCO3 |
| InChI | InChI=1S/C16H26O3/c1-11-4-5-12-10-16(18-8-9-19-16)7-6-15(2,3)14(17)13(11)12/h11-13H,4-10H2,1-3H3/t11-,12-,13-/m1/s1 |
| InChIKey | KRAKJDCXYZIHAQ-JHJVBQTASA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |