C11H16O3 — CID 11481005
(3'S,3'aR,6'aR)-3'-methylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydropentalene]-1'-one (PubChem CID 11481005) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3'S,3'aR,6'aR)-3'-methylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydropentalene]-1'-one.
| Compound Name | (3'S,3'aR,6'aR)-3'-methylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydropentalene]-1'-one |
|---|---|
| PubChem CID | 11481005 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (3'S,3'aR,6'aR)-3'-methylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydropentalene]-1'-one |
| SMILES | C[C@H]1CC(=O)[C@@H]2CCC3(OCCO3)[C@H]12 |
| InChI | InChI=1S/C11H16O3/c1-7-6-9(12)8-2-3-11(10(7)8)13-4-5-14-11/h7-8,10H,2-6H2,1H3/t7-,8-,10+/m0/s1 |
| InChIKey | ZKJVGTQCAOZPMY-OYNCUSHFSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |