C16H24O3 — CID 135048424
(3'aS,3'bS,6'aR,7'aS)-3'a,5',5'-trimethylspiro[1,3-dioxolane-2,3'-2,3b,6,6a,7,7a-hexahydro-1H-cyclopenta[a]pentalene]-4'-one (PubChem CID 135048424) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (3'aS,3'bS,6'aR,7'aS)-3'a,5',5'-trimethylspiro[1,3-dioxolane-2,3'-2,3b,6,6a,7,7a-hexahydro-1H-cyclopenta[a]pentalene]-4'-one.
| Compound Name | (3'aS,3'bS,6'aR,7'aS)-3'a,5',5'-trimethylspiro[1,3-dioxolane-2,3'-2,3b,6,6a,7,7a-hexahydro-1H-cyclopenta[a]pentalene]-4'-one |
|---|---|
| PubChem CID | 135048424 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3'aS,3'bS,6'aR,7'aS)-3'a,5',5'-trimethylspiro[1,3-dioxolane-2,3'-2,3b,6,6a,7,7a-hexahydro-1H-cyclopenta[a]pentalene]-4'-one |
| SMILES | CC1(C)C[C@H]2C[C@@H]3CCC4(OCCO4)[C@]3(C)[C@H]2C1=O |
| InChI | InChI=1S/C16H24O3/c1-14(2)9-10-8-11-4-5-16(18-6-7-19-16)15(11,3)12(10)13(14)17/h10-12H,4-9H2,1-3H3/t10-,11+,12-,15+/m1/s1 |
| InChIKey | HMAPHXYNEVUARQ-ZAZJYDDPSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |