C19H28O3 — CID 154719981
(9'S,12'R)-4',12'-dimethylspiro[1,3-dioxolane-2,14'-tetracyclo[7.6.0.01,12.04,9]pentadecane]-8'-one (PubChem CID 154719981) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (9'S,12'R)-4',12'-dimethylspiro[1,3-dioxolane-2,14'-tetracyclo[7.6.0.01,12.04,9]pentadecane]-8'-one.
| Compound Name | (9'S,12'R)-4',12'-dimethylspiro[1,3-dioxolane-2,14'-tetracyclo[7.6.0.01,12.04,9]pentadecane]-8'-one |
|---|---|
| PubChem CID | 154719981 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (9'S,12'R)-4',12'-dimethylspiro[1,3-dioxolane-2,14'-tetracyclo[7.6.0.01,12.04,9]pentadecane]-8'-one |
| SMILES | CC12CCCC(=O)[C@@]13CC[C@]1(C)CC4(CC13CC2)OCCO4 |
| InChI | InChI=1S/C19H28O3/c1-15-5-3-4-14(20)19(15)9-7-16(2)12-18(21-10-11-22-18)13-17(16,19)8-6-15/h3-13H2,1-2H3/t15?,16-,17?,19+/m1/s1 |
| InChIKey | SNOKTGAGBKWIJD-AFNJWWOFSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |