C18H30O3 — CID 91238600
1,4,7a-trimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,2,3,3a,6,7-hexahydroinden-5-one (PubChem CID 91238600) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1,4,7a-trimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,2,3,3a,6,7-hexahydroinden-5-one.
| Compound Name | 1,4,7a-trimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,2,3,3a,6,7-hexahydroinden-5-one |
|---|---|
| PubChem CID | 91238600 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 1,4,7a-trimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,2,3,3a,6,7-hexahydroinden-5-one |
| SMILES | CC1CCC2C(C)(CCC3(C)OCCO3)C(=O)CCC12C |
| InChI | InChI=1S/C18H30O3/c1-13-5-6-14-16(13,2)8-7-15(19)17(14,3)9-10-18(4)20-11-12-21-18/h13-14H,5-12H2,1-4H3 |
| InChIKey | BZPJZKHPNZXLLT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |