C11H16O3 — CID 85287811
spiro[1,3-dioxolane-2,1'-3,3a,4,6,7,7a-hexahydro-2H-indene]-5'-one (PubChem CID 85287811) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,1'-3,3a,4,6,7,7a-hexahydro-2H-indene]-5'-one.
| Compound Name | spiro[1,3-dioxolane-2,1'-3,3a,4,6,7,7a-hexahydro-2H-indene]-5'-one |
|---|---|
| PubChem CID | 85287811 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | spiro[1,3-dioxolane-2,1'-3,3a,4,6,7,7a-hexahydro-2H-indene]-5'-one |
| SMILES | O=C1CCC2C(CCC23OCCO3)C1 |
| InChI | InChI=1S/C11H16O3/c12-9-1-2-10-8(7-9)3-4-11(10)13-5-6-14-11/h8,10H,1-7H2 |
| InChIKey | NPQKFMDQRMRWER-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |