C12H18O3 — CID 10656069
(3'aS,7'aR)-7'a-methylspiro[1,3-dioxolane-2,1'-2,3,3a,4,6,7-hexahydroindene]-5'-one (PubChem CID 10656069) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (3'aS,7'aR)-7'a-methylspiro[1,3-dioxolane-2,1'-2,3,3a,4,6,7-hexahydroindene]-5'-one.
| Compound Name | (3'aS,7'aR)-7'a-methylspiro[1,3-dioxolane-2,1'-2,3,3a,4,6,7-hexahydroindene]-5'-one |
|---|---|
| PubChem CID | 10656069 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3'aS,7'aR)-7'a-methylspiro[1,3-dioxolane-2,1'-2,3,3a,4,6,7-hexahydroindene]-5'-one |
| SMILES | C[C@@]12CCC(=O)C[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C12H18O3/c1-11-4-3-10(13)8-9(11)2-5-12(11)14-6-7-15-12/h9H,2-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | ASPJLFLVEGLAPQ-GXSJLCMTSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |