C21H34O3 — CID 95565434
(1S,5R,8R,11S)-5,7,7-trimethyl-11-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]tricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 95565434) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1S,5R,8R,11S)-5,7,7-trimethyl-11-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]tricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5R,8R,11S)-5,7,7-trimethyl-11-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]tricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 95565434 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (1S,5R,8R,11S)-5,7,7-trimethyl-11-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]tricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | CC1(CCC[C@H]2CC[C@@H]3C(C)(C)C[C@@]4(C)CCC(=O)[C@@]234)OCCO1 |
| InChI | InChI=1S/C21H34O3/c1-18(2)14-19(3)11-9-17(22)21(19)15(7-8-16(18)21)6-5-10-20(4)23-12-13-24-20/h15-16H,5-14H2,1-4H3/t15-,16+,19+,21+/m0/s1 |
| InChIKey | NTWYFVKRZLBGAR-VXIWKAIFSA-N |
| XLogP | 4.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |