C15H22O3 — CID 11064835
(3aR,3bR,4R,6aS,7aS)-3b,4-dimethylspiro[1,3,3a,4,6,6a,7,7a-octahydrocyclopenta[a]pentalene-5,2'-1,3-dioxolane]-2-one (PubChem CID 11064835) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3aR,3bR,4R,6aS,7aS)-3b,4-dimethylspiro[1,3,3a,4,6,6a,7,7a-octahydrocyclopenta[a]pentalene-5,2'-1,3-dioxolane]-2-one.
| Compound Name | (3aR,3bR,4R,6aS,7aS)-3b,4-dimethylspiro[1,3,3a,4,6,6a,7,7a-octahydrocyclopenta[a]pentalene-5,2'-1,3-dioxolane]-2-one |
|---|---|
| PubChem CID | 11064835 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3aR,3bR,4R,6aS,7aS)-3b,4-dimethylspiro[1,3,3a,4,6,6a,7,7a-octahydrocyclopenta[a]pentalene-5,2'-1,3-dioxolane]-2-one |
| SMILES | C[C@H]1C2(C[C@@H]3C[C@H]4CC(=O)C[C@H]4[C@@]31C)OCCO2 |
| InChI | InChI=1S/C15H22O3/c1-9-14(2)11(8-15(9)17-3-4-18-15)5-10-6-12(16)7-13(10)14/h9-11,13H,3-8H2,1-2H3/t9-,10+,11+,13-,14-/m1/s1 |
| InChIKey | GPCWFYOROONBLB-CAFXUDQZSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |