C15H24O3 — CID 10444941
(3S,3aS,6aS)-3-(1,3-dioxolan-2-ylmethyl)-3,3a,6a-trimethyl-1,4,5,6-tetrahydropentalen-2-one (PubChem CID 10444941) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-(1,3-dioxolan-2-ylmethyl)-3,3a,6a-trimethyl-1,4,5,6-tetrahydropentalen-2-one.
| Compound Name | (3S,3aS,6aS)-3-(1,3-dioxolan-2-ylmethyl)-3,3a,6a-trimethyl-1,4,5,6-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 10444941 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3S,3aS,6aS)-3-(1,3-dioxolan-2-ylmethyl)-3,3a,6a-trimethyl-1,4,5,6-tetrahydropentalen-2-one |
| SMILES | C[C@@]12CCC[C@]1(C)[C@](C)(CC1OCCO1)C(=O)C2 |
| InChI | InChI=1S/C15H24O3/c1-13-5-4-6-15(13,3)14(2,11(16)9-13)10-12-17-7-8-18-12/h12H,4-10H2,1-3H3/t13-,14+,15-/m0/s1 |
| InChIKey | GYMGLGNHCVNKPP-ZNMIVQPWSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |