C8H12O5S — CID 134937672
ethyl 2-[(2S)-2-methyl-3-oxo-1,3-oxathiolan-2-yl]-2-oxoacetate (PubChem CID 134937672) has the molecular formula C8H12O5S and a molecular weight of 220.25 g/mol. Its IUPAC name is ethyl 2-[(2S)-2-methyl-3-oxo-1,3-oxathiolan-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(2S)-2-methyl-3-oxo-1,3-oxathiolan-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 134937672 |
| Molecular Formula | C8H12O5S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | ethyl 2-[(2S)-2-methyl-3-oxo-1,3-oxathiolan-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@@]1(C)OCCS1=O |
| InChI | InChI=1S/C8H12O5S/c1-3-12-7(10)6(9)8(2)13-4-5-14(8)11/h3-5H2,1-2H3/t8-,14?/m0/s1 |
| InChIKey | XFDOJGUSNHQNMM-BVVIDWAXSA-N |
| XLogP | -0.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|