C8H12ClNO5 — CID 12821114
ethyl (2Z)-2-[2-(chloromethyl)-1,3-dioxolan-2-yl]-2-hydroxyiminoacetate (PubChem CID 12821114) has the molecular formula C8H12ClNO5 and a molecular weight of 237.64 g/mol. Its IUPAC name is ethyl (2Z)-2-[2-(chloromethyl)-1,3-dioxolan-2-yl]-2-hydroxyiminoacetate.
| Compound Name | ethyl (2Z)-2-[2-(chloromethyl)-1,3-dioxolan-2-yl]-2-hydroxyiminoacetate |
|---|---|
| PubChem CID | 12821114 |
| Molecular Formula | C8H12ClNO5 |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | ethyl (2Z)-2-[2-(chloromethyl)-1,3-dioxolan-2-yl]-2-hydroxyiminoacetate |
| SMILES | CCOC(=O)/C(=N\O)C1(CCl)OCCO1 |
| InChI | InChI=1S/C8H12ClNO5/c1-2-13-7(11)6(10-12)8(5-9)14-3-4-15-8/h12H,2-5H2,1H3/b10-6+ |
| InChIKey | MGIHGECFPVVJPS-UXBLZVDNSA-N |
| XLogP | 0.36 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|